For research use only. Not for therapeutic Use.
Sudoterb（Cat No.:I009623）is an investigational compound being developed for its potential use in treating chronic pain and neurological disorders. It works by targeting specific receptors in the central nervous system that are involved in pain transmission and inflammatory processes. Sudoterb has demonstrated promise in preclinical studies for alleviating pain without the addictive side effects often associated with traditional painkillers like opioids. Ongoing clinical trials are assessing its safety, efficacy, and potential as a non-opioid alternative for managing pain in conditions such as neuropathic pain and fibromyalgia.
| CAS Number | 676266-31-2 |
| Synonyms | N-[2-methyl-5-phenyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]pyrrol-1-yl]pyridine-4-carboxamide |
| Molecular Formula | C29H28F3N5O |
| Purity | ≥95% |
| IUPAC Name | N-[2-methyl-5-phenyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]pyrrol-1-yl]pyridine-4-carboxamide |
| InChI | InChI=1S/C29H28F3N5O/c1-21-24(20-35-14-16-36(17-15-35)26-9-5-8-25(19-26)29(30,31)32)18-27(22-6-3-2-4-7-22)37(21)34-28(38)23-10-12-33-13-11-23/h2-13,18-19H,14-17,20H2,1H3,(H,34,38) |
| InChIKey | PRXZOPNJRFEGRH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(N1NC(=O)C2=CC=NC=C2)C3=CC=CC=C3)CN4CCN(CC4)C5=CC=CC(=C5)C(F)(F)F |
