For research use only. Not for therapeutic Use.
Sulbentine（Cat No.:I003285）is a potent, selective inhibitor of the serotonin transporter (SERT), widely used in pharmaceutical research to explore serotonin signaling pathways. By blocking the reuptake of serotonin in the brain, Sulbentine helps modulate serotonin levels, making it a valuable tool in studying disorders related to serotonin dysregulation, such as depression, anxiety, and mood disorders. This compound has applications in understanding the molecular mechanisms of selective serotonin reuptake inhibitors (SSRIs) and their role in therapeutic interventions. Sulbentine is also being evaluated for its potential in combination therapies.
| Catalog Number | I003285 |
| CAS Number | 350-12-9 |
| Molecular Formula | C17H18N2S2 |
| Purity | ≥95% |
| Target | Fungal |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 3,5-dibenzyl-1,3,5-thiadiazinane-2-thione |
| InChI | InChI=1S/C17H18N2S2/c20-17-19(12-16-9-5-2-6-10-16)13-18(14-21-17)11-15-7-3-1-4-8-15/h1-10H,11-14H2 |
| InChIKey | QFVAWNPSRQWSDU-UHFFFAOYSA-N |
| SMILES | C1N(CSC(=S)N1CC2=CC=CC=C2)CC3=CC=CC=C3 |
| Reference | <p style=/line-height:25px/> |
