For research use only. Not for therapeutic Use.
Sulconazole Nitrate（Cat No.:A000428）is a broad-spectrum antifungal agent used to treat skin infections caused by dermatophytes, yeasts, and molds, including conditions like athlete’s foot, ringworm, and candidiasis. It works by disrupting the synthesis of ergosterol, an essential component of fungal cell membranes, leading to cell death. Sulconazole Nitrate is commonly available in topical formulations such as creams and solutions, offering targeted action with minimal systemic absorption. Its efficacy and safety make it a reliable choice for managing superficial fungal infections in both acute and chronic cases.
| Catalog Number | A000428 |
| CAS Number | 61318-91-0 |
| Synonyms | NA |
| Molecular Formula | C18H15Cl3N2S.HNO3 |
| Purity | ≥95% |
| Target | Fungal |
| Storage | 3 years -20C powder |
| IUPAC Name | 1-[2-[(4-chlorophenyl)methylsulfanyl]-2-(2,4-dichlorophenyl)ethyl]imidazole;nitric acid |
| InChI | InChI=1S/C18H15Cl3N2S.HNO3/c19-14-3-1-13(2-4-14)11-24-18(10-23-8-7-22-12-23)16-6-5-15(20)9-17(16)21;2-1(3)4/h1-9,12,18H,10-11H2;(H,2,3,4) |
| InChIKey | CRKGMGQUHDNAPB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CSC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)Cl.[N+](=O)(O)[O-] |
