For research use only. Not for therapeutic Use.
Sulfadiazine-13C6 is a high-purity isotopically labeled compound essential for advanced pharmaceutical and biochemical research. This version of Sulfadiazine, featuring six carbon-13 atoms, is crucial for studies involving antibacterial mechanisms, drug metabolism, and pharmacokinetics. Its stable isotope labeling ensures precise and reliable analytical results, particularly in mass spectrometry-based assays. With enhanced stability and consistency, Sulfadiazine-13C6 is suitable for various experimental setups. Ideal for drug development and therapeutic monitoring studies, Sulfadiazine-13C6 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | S001078 |
| CAS Number | 1189426-16-1 |
| Molecular Formula | C413C6H10N4O2S |
| Purity | ≥95% |
| IUPAC Name | 4-amino-N-pyrimidin-2-yl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide |
| InChI | InChI=1S/C10H10N4O2S/c11-8-2-4-9(5-3-8)17(15,16)14-10-12-6-1-7-13-10/h1-7H,11H2,(H,12,13,14)/i2+1,3+1,4+1,5+1,8+1,9+1 |
| InChIKey | SEEPANYCNGTZFQ-AHBHZWPESA-N |
| SMILES | C1=CN=C(N=C1)NS(=O)(=O)[13C]2=[13CH][13CH]=[13C]([13CH]=[13CH]2)N |
