For research use only. Not for therapeutic Use.
Sulfameter（Cat No.:A000416）is a high-purity sulfonamide antibiotic widely used in antimicrobial research. It inhibits dihydropteroate synthase (DHPS), an enzyme crucial for bacterial folate synthesis, effectively halting bacterial growth. Sulfameter exhibits broad-spectrum activity against a range of Gram-positive and Gram-negative bacteria and is often studied for its efficacy in treating protozoal infections such as toxoplasmosis. Its stability and specificity make it a valuable tool in exploring bacterial resistance mechanisms and developing innovative therapeutic approaches. Sulfameter is essential for advancing research in antimicrobial drug discovery and infectious disease treatment.
| CAS Number | 651-06-9 |
| Synonyms | NA |
| Molecular Formula | C11H12N4O3S |
| Purity | ≥95% |
| Target | Antibiotic |
| Solubility | >9.3mg/mL in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | 4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide |
| InChI | InChI=1S/C11H12N4O3S/c1-18-9-6-13-11(14-7-9)15-19(16,17)10-4-2-8(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15) |
| InChIKey | GPTONYMQFTZPKC-UHFFFAOYSA-N |
| SMILES | COC1=CN=C(N=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
