For research use only. Not for therapeutic Use.
Sulfamethoxazole N4-glucoside is a derivative of sulfamethoxazole, an antibiotic commonly used to treat bacterial infections. This glucoside derivative enhances the solubility and pharmacokinetic properties of sulfamethoxazole, potentially improving its efficacy and reducing side effects. By conjugating with glucose, it alters the drug’s bioavailability, making it a promising candidate for pharmaceutical formulations aimed at optimizing antibiotic therapy while minimizing adverse reactions.
Catalog Number | R044825 |
CAS Number | 119691-75-7 |
Synonyms | 4-(D-Glucopyranosylamino)-N-(5-methyl-3-isoxazolyl)-benzenesulfonamide |
Molecular Formula | C16H21N3O8S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]benzenesulfonamide |
InChI | InChI=1S/C16H21N3O8S/c1-8-6-12(18-27-8)19-28(24,25)10-4-2-9(3-5-10)17-16-15(23)14(22)13(21)11(7-20)26-16/h2-6,11,13-17,20-23H,7H2,1H3,(H,18,19)/t11-,13-,14+,15-,16-/m1/s1 |
InChIKey | AKDUCXZSJFIYSD-YMILTQATSA-N |
SMILES | CC1=CC(=NO1)NS(=O)(=O)C2=CC=C(C=C2)NC3C(C(C(C(O3)CO)O)O)O |