For research use only. Not for therapeutic Use.
Sulfamonomethoxine-d4(Cat No.:S000357) is a deuterated form of sulfamonomethoxine, with four hydrogen atoms replaced by deuterium. Sulfamonomethoxine is a long-acting sulfonamide antibiotic that treats various bacterial infections in animals. The incorporation of deuterium enhances the molecule’s stability and allows for detailed pharmacokinetic and metabolic studies. These studies are crucial for understanding how sulfamonomethoxine is processed in the body, leading to insights into its absorption, distribution, metabolism, and excretion.
CAS Number | 1286538-12-2 |
Molecular Formula | C11H8D4N4O3S |
Purity | ≥95% |
Target | Bacterial |
IUPAC Name | 4-amino-2,3,5,6-tetradeuterio-N-(6-methoxypyrimidin-4-yl)benzenesulfonamide |
InChI | InChI=1S/C11H12N4O3S/c1-18-11-6-10(13-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,14,15)/i2D,3D,4D,5D |
InChIKey | WMPXPUYPYQKQCX-QFFDRWTDSA-N |
SMILES | COC1=NC=NC(=C1)NS(=O)(=O)C2=CC=C(C=C2)N |