For research use only. Not for therapeutic Use.
Sulfamonomethoxine（Cat No.:I000845）is a sulfonamide antibacterial agent known for its long-acting properties. It is used in blood kinetic studies to evaluate its distribution and elimination in the body. Sulfamonomethoxine exerts its antibacterial effects by blocking the synthesis of folic acid in bacteria. It does so by inhibiting the enzyme dihydropteroate synthetase, which is involved in the production of folic acid. By interfering with folic acid synthesis, Sulfamonomethoxine inhibits the growth and reproduction of bacteria, making it an effective treatment option for certain bacterial infections.
| Catalog Number | I000845 |
| CAS Number | 1220-83-3 |
| Molecular Formula | C11H12N4O3S |
| Purity | ≥95% |
| Target | Bacterial |
| Solubility | DMSO:42mg/mL |
| Storage | 2-8°C |
| IUPAC Name | 4-amino-N-(6-methoxypyrimidin-4-yl)benzenesulfonamide |
| InChI | InChI=1S/C11H12N4O3S/c1-18-11-6-10(13-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,14,15) |
| InChIKey | WMPXPUYPYQKQCX-UHFFFAOYSA-N |
| SMILES | COC1=NC=NC(=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
| Reference | <p style=/line-height:25px/> |
