For research use only. Not for therapeutic Use.
Sulfapyridine（Cat No.:A000409）is a sulfonamide antimicrobial agent primarily used in the treatment of infections caused by susceptible bacteria. It is the active metabolite of the prodrug sulfasalazine, commonly used in treating inflammatory bowel diseases such as ulcerative colitis and Crohn’s disease. Sulfapyridine works by inhibiting bacterial folic acid synthesis, which disrupts DNA synthesis and bacterial growth. In addition to its antimicrobial properties, it has anti-inflammatory effects, making it useful in treating autoimmune conditions. The compound is often administered in combination with other agents for enhanced therapeutic efficacy.
| Catalog Number | A000409 |
| CAS Number | 144-83-2 |
| Synonyms | 144-83-2; Sulphapyridine; 2-Sulfapyridine; Sulfidin; Sulfidine |
| Molecular Formula | C11H11N3O2S |
| Purity | ≥95% |
| Target | Bacterial |
| Solubility | Limited solubility |
| Storage | -20°C |
| IUPAC Name | 4-amino-N-pyridin-2-ylbenzenesulfonamide |
| InChI | InChI=1S/C11H11N3O2S/c12-9-4-6-10(7-5-9)17(15,16)14-11-3-1-2-8-13-11/h1-8H,12H2,(H,13,14) |
| InChIKey | GECHUMIMRBOMGK-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
| Reference | 1: Xiong H, Chen S, Luo X. Salazosulfapyridine-related Stevens-Johnson Syndrome 2: Chen KL, Liu LC, Chen WR. Adsorption of sulfamethoxazole and sulfapyridine 3: Ji Y, Shi Y, Wang L, Lu J, Ferronato C, Chovelon JM. Sulfate radical-based 4: Yao Y, Zhang Y, Gao B, Chen R, Wu F. Removal of sulfamethoxazole (SMX) and 5: Hassani NE, Baraket A, Neto ET, Lee M, Salvador JP, Marco MP, Bausells J, Bari 6: García-Galán MJ, Anfruns A, Gonzalez-Olmos R, Rodriguez-Mozaz S, Comas J. 7: Li Y, Chen J, Qiao X, Zhang H, Zhang YN, Zhou C. Insights into photolytic 8: Hursthouse MB, Hughes DS, Gelbrich T, Threlfall TL. Describing hydrogen-bonded 9: Inyang M, Gao B, Zimmerman A, Zhou Y, Cao X. Sorption and cosorption of lead 10: Xu J, Hao Z, Guo C, Zhang Y, He Y, Meng W. Photodegradation of sulfapyridine |
