For research use only. Not for therapeutic Use.
Sulfatinib (HMPL-012) is a potent and highly selective tyrosine kinase inhibitor against VEGFR1/2/3, FGFR1 and CSF1R with IC50s of in a range of 1 to 24 nM.
| Catalog Number | I013757 |
| CAS Number | 1308672-74-3 |
| Molecular Formula | C₂₄H₂₈N₆O₃S |
| Purity | ≥95% |
| Target | FGFR VEGFR |
| Solubility | DMSO: ≥ 30 mg/mL |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-1-[3-[[4-[(2-methyl-1H-indol-5-yl)oxy]pyrimidin-2-yl]amino]phenyl]methanesulfonamide |
| InChI | InChI=1S/C24H28N6O3S/c1-17-13-19-15-21(7-8-22(19)27-17)33-23-9-10-25-24(29-23)28-20-6-4-5-18(14-20)16-34(31,32)26-11-12-30(2)3/h4-10,13-15,26-27H,11-12,16H2,1-3H3,(H,25,28,29) |
| InChIKey | TTZSNFLLYPYKIL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C=CC(=C2)OC3=NC(=NC=C3)NC4=CC=CC(=C4)CS(=O)(=O)NCCN(C)C |
| Reference | [1]. PCT Int. Appl. (2011), WO 2011060746 A1 20110526. |
