For research use only. Not for therapeutic Use.
Sulfo-SPDB-DM4 (Cat No.: I013232) is a linker-drug conjugate used in antibody-drug conjugate (ADC) therapies, designed to deliver potent cytotoxic agents specifically to cancer cells. The compound consists of a cytotoxic drug, DM4, linked to a targeting molecule, sulfo-SPDB, which facilitates attachment to antibodies. DM4 is a potent microtubule inhibitor that prevents cancer cell division. Sulfo-SPDB-DM4 is studied for its potential to selectively target and kill tumor cells while minimizing off-target effects, improving the efficacy and safety of cancer treatments in clinical trials.
| CAS Number | 1626359-59-8 |
| Molecular Formula | C₄₆H₆₃ClN₄O₁₇S₃ |
| Purity | ≥95% |
| Target | Drug-Linker Conjugates for ADC |
| Solubility | DMSO |
| InChI | InChI=1S/C46H63ClN4O17S3/c1-25-12-11-13-33(64-10)46(59)24-31(65-43(58)48-46)26(2)40-45(6,67-40)34(23-38(55)50(8)29-21-28(20-25)22-30(63-9)39(29)47)66-41(56)27(3)49(7)35(52)16-18-44(4,5)70-69-19-17-32(71(60,61)62)42(57)68-51-36(53)14-15-37(51)54/h11-13,21-22,26-27,31-34,40,59H,14-20,23-24H2,1-10H3,(H,48,58)(H,60,61,62)/b13-11+,25-12+/t26-,27+,31+,32?,33-,34+,40+,45+,46+/m1/s1 |
| InChIKey | ACJLJPQSHWOFQD-SKUWBIDSSA-N |
| SMILES | CC1C2CC(C(C=CC=C(CC3=CC(=C(C(=C3)OC)Cl)N(C(=O)CC(C4(C1O4)C)OC(=O)C(C)N(C)C(=O)CCC(C)(C)SSCCC(C(=O)ON5C(=O)CCC5=O)S(=O)(=O)O)C)C)OC)(NC(=O)O2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
