For research use only. Not for therapeutic Use.
Sulfonated aliphatic polyester（Cat No.:M123783）, is a chemical compound known for its use as an ionic surfactant and dispersing agent in various industrial applications. This compound is highly water-soluble and has a wide range of uses in industries such as textiles, detergents, and coatings. Sulfonated aliphatic polyester helps to improve the dispersibility of pigments and other solid particles in aqueous systems, making it a valuable additive in paint and ink formulations. Its excellent surfactant properties also make it useful in the production of emulsions and foaming agents. Sulfonated aliphatic polyester plays a significant role in enhancing product performance and stability.
| Catalog Number | M123783 |
| CAS Number | 1639-66-3 |
| Molecular Formula | C20H37NaO7S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | sodium;1,4-dioctoxy-1,4-dioxobutane-2-sulfonate |
| InChI | InChI=1S/C20H38O7S.Na/c1-3-5-7-9-11-13-15-26-19(21)17-18(28(23,24)25)20(22)27-16-14-12-10-8-6-4-2;/h18H,3-17H2,1-2H3,(H,23,24,25);/q;+1/p-1 |
| InChIKey | RCIJACVHOIKRAP-UHFFFAOYSA-M |
| SMILES | CCCCCCCCOC(=O)CC(C(=O)OCCCCCCCC)S(=O)(=O)[O-].[Na+] |
