For research use only. Not for therapeutic Use.
Sulforaphene（Cat No.:R024381）is a naturally occurring isothiocyanate found in cruciferous vegetables, particularly radish seeds and sprouts. Known for its potent antioxidant and anti-carcinogenic properties, Sulforaphene plays a crucial role in detoxification processes and protection against oxidative stress. It has shown promise in cancer prevention and treatment, as well as in managing inflammation and microbial infections. High-purity Sulforaphene is essential for scientific research and nutraceutical development, providing reliable and effective results for those exploring its health benefits and therapeutic potential.
| Catalog Number | R024381 |
| CAS Number | 592-95-0 |
| Synonyms | Isothiocyanic Acid 4-(Methylsulfinyl)-3-butenyl Ester; Sulforaphen;4-Methylsulfinyl-3-butenyl Isothiocyanate; 4-Methylsulfinylbut-3-enyl Isothiocyanate?Raphanin; |
| Molecular Formula | C6H9NOS2 |
| Purity | ≥95% |
| Target | Protein Tyrosine Kinase/RTK |
| Storage | -20°C |
| IUPAC Name | (E)-4-isothiocyanato-1-methylsulfinylbut-1-ene |
| InChI | InChI=1S/C6H9NOS2/c1-10(8)5-3-2-4-7-6-9/h3,5H,2,4H2,1H3/b5-3+ |
| InChIKey | QKGJFQMGPDVOQE-HWKANZROSA-N |
| SMILES | CS(=O)C=CCCN=C=S |
