For research use only. Not for therapeutic Use.
Sulfosuccinimidyl elaidate sodium(Cat No.:R043845), is a chemical compound used in bioconjugation and protein modification techniques. It is a water-soluble and stable reagent derived from elaidic acid, containing a succinimidyl ester and a sulfonate group. This compound is commonly employed in protein labeling and cross-linking experiments, enabling the covalent attachment of biomolecules to other molecules or surfaces. Its specific properties make it a valuable tool in various biochemical and biomedical research applications, such as antibody conjugation and immunoassays.
CAS Number | 1212012-37-7 |
Synonyms | 2,5-Dioxo-1-[[(9E)-1-oxo-9-octadecenyl]oxy]-3-pyrrolidinesulfonic Acid Sodium;?(E)-2,5-Dioxo-1-[(1-oxo-9-octadecenyl)oxy]-3-pyrrolidinesulfonic Acid Sodium; Elaidic acid N-Hydroxysulfosuccinamide ester sodium salt |
Molecular Formula | C22H36NNaO7S |
Purity | ≥95% |
Target | Mitophagy |
Storage | -20°C |
IUPAC Name | sodium;1-[(Z)-octadec-9-enoyl]oxy-2,5-dioxopyrrolidine-3-sulfonate |
InChI | InChI=1S/C22H37NO7S.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)30-23-20(24)18-19(22(23)26)31(27,28)29;/h9-10,19H,2-8,11-18H2,1H3,(H,27,28,29);/q;+1/p-1/b10-9-; |
InChIKey | FZVVLJSNKVOPRF-KVVVOXFISA-M |
SMILES | CCCCCCCCC=CCCCCCCCC(=O)ON1C(=O)CC(C1=O)S(=O)(=O)[O-].[Na+] |