For research use only. Not for therapeutic Use.
Sulisobenzone（Cat No.:I003483）, is a member of the benzophenone compound family. Its primary application is in everyday sunscreen and skincare products to protect the skin from the aging effects of ultraviolet (UV) rays. Sulisobenzone functions as a UV filter, absorbing and dissipating harmful UV radiation, thereby reducing the risk of sun-induced skin damage such as premature aging and sunburn. Additionally, it finds utility in water-based paints, dyes, and cleansing products, where UV protection or light stability is required.
| Catalog Number | I003483 |
| CAS Number | 4065-45-6 |
| Molecular Formula | C14H12O6S |
| Purity | ≥95% |
| Solubility | DMSO:34mg/mL |
| Storage | Room Temperature |
| IUPAC Name | 5-benzoyl-4-hydroxy-2-methoxybenzenesulfonic acid |
| InChI | InChI=1S/C14H12O6S/c1-20-12-8-11(15)10(7-13(12)21(17,18)19)14(16)9-5-3-2-4-6-9/h2-8,15H,1H3,(H,17,18,19) |
| InChIKey | CXVGEDCSTKKODG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)O)C(=O)C2=CC=CC=C2)S(=O)(=O)O |
| Reference | <p style=/line-height:25px/> |
