For research use only. Not for therapeutic Use.
Sumanene is a bowl-shaped polycyclic aromatic hydrocarbon used in advanced materials science and nanotechnology. Its unique structure, resembling a fragment of fullerene, makes it valuable in developing organic semiconductors and molecular electronics. Sumanene is significant in research focused on creating novel carbon-based materials, enhancing the understanding of molecular geometry, and exploring new applications in electronic devices.
| Catalog Number | R025276 |
| CAS Number | 151253-59-7 |
| Synonyms | 4,7-Dihydro-1H-tricyclopenta[def,jkl,pqr]triphenylene |
| Molecular Formula | C21H12 |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C21H12/c1-2-11-8-13-5-6-15-9-14-4-3-12-7-10(1)16-17(11)19(13)21(15)20(14)18(12)16/h1-6H,7-9H2 |
| InChIKey | WOYKPMSXBVTRKZ-UHFFFAOYSA-N |
| SMILES | C1C2=C3C4=C(CC5=C4C6=C(CC7=C6C3=C1C=C7)C=C5)C=C2 |
