For research use only. Not for therapeutic Use.
sunvozertinibum is (Cat.No:I036853) a tyrosine kinase inhibitor an antineoplastic
| Catalog Number | I036853 |
| CAS Number | 2370013-12-8 |
| Synonyms | sunvozertinibum; sunvozertinib |
| Molecular Formula | C29H35ClFN7O3 |
| Purity | 98% |
| Target | Protein Tyrosine Kinase/RTK |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | N-{5-({4-[5-chloro-4-fluoro-2-(2-hydroxypropan-2-yl)anilino]pyrimidin-2-yl}amino)-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-4-methoxyphenyl}prop-2-enamide |
| InChI | InChI=1S/C29H35ClFN7O3/c1-7-27(39)34-22-14-23(25(41-6)15-24(22)38-11-9-17(16-38)37(4)5)35-28-32-10-8-26(36-28)33-21-13-19(30)20(31)12-18(21)29(2,3)40/h7-8,10,12-15,17,40H,1,9,11,16H2,2-6H3,(H,34,39)(H2,32,33,35,36)/t17-/m1/s1 |
| InChIKey | BTMKEDDEMKKSEF-QGZVFWFLSA-N |
| SMILES | C=CC(NC1=CC(NC2=NC=CC(NC3=CC(Cl)=C(F)C=C3C(C)(O)C)=N2)=C(OC)C=C1N4C[C@H](N(C)C)CC4)=O |
