For research use only. Not for therapeutic Use.
Supercinnamaldehyde is an activator of the transient receptor potential ankyrin 1 (TRPA1) channel (EC<sub>50</sub> = 0.8 µM) and an analog of cinnamaldehyde. TRPA1 is a nociceptor expressed on sensory neurons and is activated by hot and cold temperatures, mechanical stimuli, and pain.
| Catalog Number | R066889 |
| CAS Number | 70351-51-8 |
| Synonyms | 1,3-dihydro-1-methyl-3-(2-oxopropylidene)-2H-indol-2-one |
| Molecular Formula | C12H11NO2 |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C12H11NO2/c1-8(14)7-10-9-5-3-4-6-11(9)13(2)12(10)15/h3-7H,1-2H3/b10-7- |
| InChIKey | CZKBLHCEDVWPRN-YFHOEESVSA-N |
| SMILES | CN(C1=CC=CC=C1/C2=C/C(C)=O)C2=O |
| Reference | 1.Macpherson, L.J.,Dubin, A.E.,Evans, M.J., et al. Noxious compounds activate TRPA1 ion channels through covalent modification of cysteines. Nature 445(7127), 541-545 (2007). |
