For research use only. Not for therapeutic Use.
SW-044248 (CAT: I003909) is a promising noncanonical topoisomerase 1 (Top1) inhibitor that exhibits a distinct pattern of selective toxicity against non-small cell lung cancer (NSCLC) cells. This compound effectively disrupts Top1-mediated DNA processes in a unique manner, making it a potential candidate for targeted therapy against NSCLC. SW-044248’s specific cytotoxicity towards NSCLC cells suggests its potential utility in the development of innovative strategies for treating this type of cancer, highlighting its significance as a novel therapeutic agent in oncology research.
CAS Number | 522650-83-5 |
Molecular Formula | C22H23N5O2S |
Purity | ≥95% |
Target | Topoisomerase |
Solubility | DMSO: ≥ 30 mg/mL |
Storage | -20°C |
IUPAC Name | 2-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(2-methoxyphenyl)butanamide |
InChI | InChI=1S/C22H23N5O2S/c1-4-18(21(28)23-15-11-7-9-13-17(15)29-3)30-22-24-20-19(25-26-22)14-10-6-8-12-16(14)27(20)5-2/h6-13,18H,4-5H2,1-3H3,(H,23,28) |
InChIKey | PEVRGVRHMMZNGI-UHFFFAOYSA-N |
SMILES | CCC(C(=O)NC1=CC=CC=C1OC)SC2=NC3=C(C4=CC=CC=C4N3CC)N=N2 |
Reference | <p style=/line-height:25px/> |