For research use only. Not for therapeutic Use.
Swainsonine (Cat No.: R000441) is a naturally occurring alkaloid found in plants such as Swainsona species and Locoweed (Astragalus spp.), as well as in certain fungi. It inhibits the enzyme alpha-mannosidase, disrupting glycoprotein processing and leading to the accumulation of mannose-containing oligosaccharides in cells. This can affect cellular function and growth, and is associated with neurotoxic and teratogenic effects in livestock that consume these plants. Swainsonine has been studied for its potential therapeutic applications, including its effects on cancer and certain viral infections.
| CAS Number | 72741-87-8 |
| Synonyms | 8α,β-Octahydroindolizidine-1α,2α,8β-triol; (-)-Swainsonine; Tridolgosir; (1S,2R,8R,8aR)-Octahydroindolizidinetriol |
| Molecular Formula | C8H15NO3 |
| Purity | ≥95% |
| Target | Anti-infection |
| Solubility | Soluble to 50 mM in sterile water |
| Storage | Store at -20℃ |
| IUPAC Name | (1S,2R,8R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol |
| InChI | InChI=1S/C8H15NO3/c10-5-2-1-3-9-4-6(11)8(12)7(5)9/h5-8,10-12H,1-4H2/t5-,6-,7-,8-/m1/s1 |
| InChIKey | FXUAIOOAOAVCGD-WCTZXXKLSA-N |
| SMILES | C1CC(C2C(C(CN2C1)O)O)O |
