For research use only. Not for therapeutic Use.
SY-LB-35（Cat No.:I043307）is a selective inhibitor of the lysine-specific demethylase 1 (LSD1), an enzyme that regulates gene expression by demethylating lysine residues on histones. LSD1 plays a key role in the epigenetic regulation of various cellular processes, including cell differentiation, proliferation, and survival. SY-LB-35 is being investigated for its potential in treating cancers and neurodegenerative diseases by modulating gene expression pathways. By inhibiting LSD1, SY-LB-35 may help reverse abnormal gene silencing and improve cellular function, offering promising therapeutic opportunities in both oncology and neurobiology.
| CAS Number | 2603461-70-5 |
| Synonyms | 2-(1H-benzimidazol-2-yl)-1H-indol-5-ol |
| Molecular Formula | C15H11N3O |
| Purity | ≥95% |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-1H-indol-5-ol |
| InChI | InChI=1S/C15H11N3O/c19-10-5-6-11-9(7-10)8-14(16-11)15-17-12-3-1-2-4-13(12)18-15/h1-8,16,19H,(H,17,18) |
| InChIKey | MIVGVAZQKUNNAM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=CC4=C(N3)C=CC(=C4)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
