For research use only. Not for therapeutic Use.
SY2-062 (CAT: I036885), also referred to as 4-bromo-thalidomide, is a derivative of thalidomide. This compound holds significance as a valuable precursor in the synthesis of thalidomide-based PROTAC degraders. PROTACs, or proteolysis-targeting chimeras, are innovative molecules designed to selectively degrade target proteins within cells. By utilizing SY2-062 as a starting material, researchers can strategically engineer thalidomide-based PROTAC degraders, which have the potential to revolutionize targeted protein degradation strategies and contribute to advancements in drug development for various diseases and therapeutic applications.
| CAS Number | 2093536-12-8 |
| Synonyms | SY2-062; SY-2-062; SY 2-062; SY2062; SY-2062; SY 2062; 4-bromo-thalidomide; |
| Molecular Formula | C13H9BrN2O4 |
| Purity | 98% |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 4-Bromo-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione |
| InChI | InChI=1S/C13H9BrN2O4/c14-7-3-1-2-6-10(7)13(20)16(12(6)19)8-4-5-9(17)15-11(8)18/h1-3,8H,4-5H2,(H,15,17,18) |
| InChIKey | NUICQRZENMKDBW-UHFFFAOYSA-N |
| SMILES | O=C1N(C(CC2)C(NC2=O)=O)C(C3=C1C=CC=C3Br)=O |
