For research use only. Not for therapeutic Use.
Spleen tyrosine kinase (Syk) inhibitors (Cat No.: I011363) are small molecules that selectively target Syk, a key regulator of immune cell signaling and inflammation. By blocking Syk activity, these inhibitors prevent downstream signaling involved in B-cell receptor (BCR) and Fc receptor-mediated immune responses. Syk inhibitors are widely studied for their therapeutic potential in autoimmune diseases, allergic reactions, and certain cancers, such as B-cell malignancies. They serve as valuable tools in immunology and oncology research, helping to elucidate Syk’s role in disease progression.
| CAS Number | 622387-85-3 |
| Synonyms | 2,3-Dihydro-3-[(1-methyl-1H-indol-3-yl)methylene]-2-oxo-1H-indole-5-sulfonamide |
| Molecular Formula | C₁₈H₁₅N₃O₃S |
| Purity | ≥95% |
| Target | Syk |
| Solubility | Soluble to 100 mM in DMSO |
| Storage | Store at -20°C |
| InChI | InChI=1S/C18H15N3O3S/c1-21-10-11(13-4-2-3-5-17(13)21)8-15-14-9-12(25(19,23)24)6-7-16(14)20-18(15)22/h2-10H,1H3,(H,20,22)(H2,19,23,24)/b15-8- |
| InChIKey | MLKHXLFEYOOYEY-NVNXTCNLSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C=C3C4=C(C=CC(=C4)S(=O)(=O)N)NC3=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
