For research use only. Not for therapeutic Use.
R406(Cat No.:I005038)is a potent and selective inhibitor of spleen tyrosine kinase (SYK), a key regulator in immune cell signaling and activation. By inhibiting SYK, R406 disrupts pathways involved in inflammatory responses, making it valuable in research on autoimmune and inflammatory diseases. It has been studied for its potential in treating conditions such as rheumatoid arthritis and immune thrombocytopenia (ITP). Additionally, R406 is being explored for its anticancer properties, as SYK plays a role in certain hematologic malignancies, particularly in B-cell receptor signaling pathways.
CAS Number | 841290-80-0 |
Synonyms | 6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
Molecular Formula | C₂₂H₂₃FN₆O₅ |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO 20 mg/ml |
Storage | 3 years -20℃ powder |
IC50 | 41 nM |
IUPAC Name | 6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
InChI | InChI=1S/C22H23FN6O5/c1-22(2)20(30)28-19-13(34-22)6-7-16(27-19)26-18-12(23)10-24-21(29-18)25-11-8-14(31-3)17(33-5)15(9-11)32-4/h6-10H,1-5H3,(H3,24,25,26,27,28,29,30) |
InChIKey | NHHQJBCNYHBUSI-UHFFFAOYSA-N |
SMILES | CC1(C(=O)NC2=C(O1)C=CC(=N2)NC3=NC(=NC=C3F)NC4=CC(=C(C(=C4)OC)OC)OC)C |
Reference | <p style=/line-height:25px/> |