For research use only. Not for therapeutic Use.
Synephrine hydrochloride (Cat.No:I012191) is a naturally occurring alkaloid found in certain citrus fruits. It is commonly used in dietary supplements and weight loss products for its potential to promote thermogenesis and suppress appetite. Synephrine hydrochloride is believed to have similar effects to ephedrine, but with less risk of adverse cardiovascular effects.
| Catalog Number | I012191 |
| CAS Number | 835904-51-3 |
| Synonyms | GSK1349571A; N-(2/’,5/’-Dimethoxy[1,1/’-biphenyl]-4-yl)-3-fluoro-4-pyridinecarboxamide |
| Molecular Formula | C20H17FN2O3 |
| Purity | ≥95% |
| Target | CRAC Channel |
| InChI | InChI=1S/C20H17FN2O3/c1-25-15-7-8-19(26-2)17(11-15)13-3-5-14(6-4-13)23-20(24)16-9-10-22-12-18(16)21/h3-12H,1-2H3,(H,23,24) |
| InChIKey | GFEIWXNLDKUWIK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C2=CC=C(C=C2)NC(=O)C3=C(C=NC=C3)F |
