For research use only. Not for therapeutic Use.
Synthalin sulfate（Cat No.:I010254）is a synthetic, water-soluble compound that has been explored for its potential use in treating conditions like diabetes. It works by mimicking the action of insulin, helping to regulate blood sugar levels in the body. Synthalin sulfate is thought to enhance glucose uptake and improve insulin sensitivity, making it useful for managing insulin-resistant states such as type 2 diabetes. However, it is not commonly used in clinical practice due to the development of more effective treatments. Research into its mechanisms and potential side effects continues in the field of metabolic disease management.
| Catalog Number | I010254 |
| CAS Number | 182285-12-7 |
| Synonyms | N,N/’-1,10-Decanediylbisguanidine sulfate |
| Molecular Formula | C12H30N6O4S |
| Purity | ≥95% |
| Target | NMDA Receptor |
| Solubility | Soluble to 5 mM in water |
| Storage | Store at RT |
| IUPAC Name | 2-[10-(diaminomethylideneamino)decyl]guanidine;sulfuric acid |
| InChI | InChI=1S/C12H28N6.H2O4S/c13-11(14)17-9-7-5-3-1-2-4-6-8-10-18-12(15)16;1-5(2,3)4/h1-10H2,(H4,13,14,17)(H4,15,16,18);(H2,1,2,3,4) |
| InChIKey | MNKRJRJDADVBJJ-UHFFFAOYSA-N |
| SMILES | C(CCCCCN=C(N)N)CCCCN=C(N)N.OS(=O)(=O)O |
