For research use only. Not for therapeutic Use.
(+)-Syringaresinol is a lignan compound commonly found in plants like flaxseed and sesame. This natural product exhibits antioxidant properties and has been investigated for its potential health benefits. Research suggests that (+)-Syringaresinol may have protective effects against oxidative stress-related diseases such as cardiovascular disorders and cancer. Additionally, it shows promise in skincare formulations due to its ability to promote skin health and elasticity. Ongoing studies continue to explore its therapeutic potential and elucidate its mechanisms of action, with potential applications in both pharmaceuticals and cosmetics.
CAS Number | 21453-69-0 |
Molecular Formula | C22H26O8 |
Purity | ≥95% |
Target | Nuclear Factor of activated T Cells (NFAT) |
Storage | -20°C |
IUPAC Name | 4-[(3S,3aR,6S,6aR)-6-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2,6-dimethoxyphenol |
InChI | InChI=1S/C22H26O8/c1-25-15-5-11(6-16(26-2)19(15)23)21-13-9-30-22(14(13)10-29-21)12-7-17(27-3)20(24)18(8-12)28-4/h5-8,13-14,21-24H,9-10H2,1-4H3/t13-,14-,21+,22+/m0/s1 |
InChIKey | KOWMJRJXZMEZLD-HCIHMXRSSA-N |
SMILES | COC1=CC(=CC(=C1O)OC)C2C3COC(C3CO2)C4=CC(=C(C(=C4)OC)O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |