For research use only. Not for therapeutic Use.
Syrosingopine（Cat No.:I010174）, is a chemical compound that was once used in combination with another drug, ouabain, for experimental purposes in cardiovascular research. This combination was used to study the effects of sodium-potassium pumps in cardiac cells and their potential relevance to hypertension and heart disease. However, syrosingopine is not approved for medical use in most countries and is not commonly prescribed. It is primarily known for its historical significance in scientific research rather than its practical clinical applications.
| Catalog Number | I010174 |
| CAS Number | 84-36-6 |
| Synonyms | SYROSINGOPINE;18-[[4-[(Ethoxycarbonyl)oxy]-3,5-dimethoxybenzoyl]oxy]-11,17-dimethoxy-yohimban-16-carboxylic acid methyl ester;3beta,20alpha-Yohimban-16beta-carboxylic acid, 18beta-hydroxy-11,17alpha-dimethoxy-, methyl ester, 4-hydroxy-3,5-dimethoxybe |
| Molecular Formula | C₃₅H₄₂N₂O₁₁ |
| Purity | ≥95% |
| Target | Monocarboxylate Transporter |
| Storage | Store at -20°C |
| IUPAC Name | methyl (1R,15S,17R,18R,19S,20S)-17-(4-ethoxycarbonyloxy-3,5-dimethoxybenzoyl)oxy-6,18-dimethoxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate |
| InChI | InChI=1S/C35H42N2O11/c1-7-46-35(40)48-31-26(42-3)12-18(13-27(31)43-4)33(38)47-28-14-19-17-37-11-10-22-21-9-8-20(41-2)15-24(21)36-30(22)25(37)16-23(19)29(32(28)44-5)34(39)45-6/h8-9,12-13,15,19,23,25,28-29,32,36H,7,10-11,14,16-17H2,1-6H3/t19-,23+,25-,28-,29+,32+/m1/s1 |
| InChIKey | ZCDNRPPFBQDQHR-SSYATKPKSA-N |
| SMILES | CCOC(=O)OC1=C(C=C(C=C1OC)C(=O)OC2CC3CN4CCC5=C(C4CC3C(C2OC)C(=O)OC)NC6=C5C=CC(=C6)OC)OC |
| Reference | 1: Furukawa T, Sano T, Kohno Y, Koga M, Nagasaki N. Selective depleting effect of |
