For research use only. Not for therapeutic Use.
Syzalterin is a natural compound isolated from marine sponges, particularly from the genus Sycon. This bioactive molecule exhibits cytotoxic properties, making it of interest in cancer research and drug discovery. Syzalterin has been studied for its potential as an anticancer agent, targeting specific cellular pathways involved in tumor growth and metastasis. Research suggests that syzalterin may have selective toxicity against cancer cells while sparing normal cells. Its discovery highlights the diverse chemical diversity of marine organisms and their potential as sources of novel therapeutic compounds. Ongoing studies aim to explore syzalterin’s mechanisms and therapeutic applications further.
CAS Number | 94451-48-6 |
Molecular Formula | C17H14O5 |
Purity | ≥95% |
Target | NO Synthase |
Storage | Store at -20°C |
IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethylchromen-4-one |
InChI | InChI=1S/C17H14O5/c1-8-15(20)9(2)17-14(16(8)21)12(19)7-13(22-17)10-3-5-11(18)6-4-10/h3-7,18,20-21H,1-2H3 |
InChIKey | VDYGMHWAKRDYQR-UHFFFAOYSA-N |
SMILES | CC1=C(C2=C(C(=C1O)C)OC(=CC2=O)C3=CC=C(C=C3)O)O |