For research use only. Not for therapeutic Use.
T-1101 tosylate (Cat.No:I017178) is a synthetic compound known for its antiviral properties, particularly against human immunodeficiency virus (HIV). It is a nucleoside reverse transcriptase inhibitor (NRTI) that works by inhibiting the reverse transcriptase enzyme, which is crucial for HIV replication. T-1101 tosylate has shown promise in preclinical studies for its ability to reduce viral load and improve immune function in HIV-infected individuals. Although still under investigation, it represents a potential therapeutic option in the fight against HIV/AIDS.
CAS Number | 2250404-95-4 |
Molecular Formula | C₃₁H₃₁N₅O₆S₃ |
Purity | ≥95% |
Target | Apoptosis |
IUPAC Name | N-[4-[4-[5-(2-methoxyethoxy)pyrazin-2-yl]sulfanyl-2,6-dimethylphenyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide;4-methylbenzenesulfonic acid |
InChI | 1S/C24H23N5O3S2.C7H8O3S/c1-15-10-18(34-21-13-26-20(12-27-21)32-9-8-31-3)11-16(2)22(15)19-14-33-24(28-19)29-23(30)17-4-6-25-7-5-17;1-6-2-4-7(5-3-6)11(8,9)10/h4-7,10-14H,8-9H2,1-3H3,(H,28,29,30);2-5H,1H3,(H,8,9,10) |
InChIKey | OUJWEAVKLYQREM-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC1=CC(=CC(=C1C2=CSC(=N2)NC(=O)C3=CC=NC=C3)C)SC4=NC=C(N=C4)OCCOC |