For research use only. Not for therapeutic Use.
T-3364366（Cat No.:I009662）is a selective inhibitor of the protein kinase CK2 (Casein Kinase 2), a serine/threonine kinase involved in regulating cell growth, survival, and stress responses. CK2 is implicated in various pathological conditions, including cancer, inflammation, and neurodegenerative diseases, due to its role in controlling key signaling pathways. By targeting CK2, T-3364366 aims to suppress abnormal cell proliferation and promote apoptosis in cancer cells. Its high specificity and potential to modulate CK2’s activity make it a promising candidate for developing targeted therapies in oncology and other CK2-related disorders.
| CAS Number | 1356354-09-0 |
| Synonyms | N-[2-[4-oxo-3-[4-(2,2,2-trifluoroethoxy)phenyl]thieno[3,4-d]pyrimidin-2-yl]sulfanylethyl]acetamide |
| Molecular Formula | C18H16F3N3O3S2 |
| Purity | ≥95% |
| IUPAC Name | N-[2-[4-oxo-3-[4-(2,2,2-trifluoroethoxy)phenyl]thieno[3,4-d]pyrimidin-2-yl]sulfanylethyl]acetamide |
| InChI | InChI=1S/C18H16F3N3O3S2/c1-11(25)22-6-7-29-17-23-15-9-28-8-14(15)16(26)24(17)12-2-4-13(5-3-12)27-10-18(19,20)21/h2-5,8-9H,6-7,10H2,1H3,(H,22,25) |
| InChIKey | BVRXQXNVDLUWMV-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCSC1=NC2=CSC=C2C(=O)N1C3=CC=C(C=C3)OCC(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
