For research use only. Not for therapeutic Use.
T025（Cat No.:I019367）is a selective inhibitor of the protein kinase GSK-3β (glycogen synthase kinase 3 beta), an enzyme involved in various cellular processes, including glycogen metabolism, cell signaling, and development. By inhibiting GSK-3β, T025 modulates pathways linked to cell proliferation, differentiation, and survival, making it a candidate for studying conditions like cancer, diabetes, and neurodegenerative diseases. Research indicates that T025 may promote neuroprotective effects and enhance insulin signaling, providing insights into its therapeutic potential. Its specificity for GSK-3β over other kinases makes it a valuable tool in pharmacological studies and drug development.
| Catalog Number | I019367 |
| CAS Number | 2407433-00-3 |
| Molecular Formula | C₂₁H₁₈N₈ |
| Purity | ≥95% |
| IUPAC Name | 2-N-methyl-4-N-(pyrimidin-2-ylmethyl)-5-quinolin-6-yl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| InChI | InChI=1S/C21H18N8/c1-22-21-28-19-18(20(29-21)27-12-17-24-8-3-9-25-17)15(11-26-19)13-5-6-16-14(10-13)4-2-7-23-16/h2-11H,12H2,1H3,(H3,22,26,27,28,29) |
| InChIKey | PMWVYONICYRLNY-UHFFFAOYSA-N |
| SMILES | CNC1=NC2=C(C(=CN2)C3=CC4=C(C=C3)N=CC=C4)C(=N1)NCC5=NC=CC=N5 |
| Reference | [1]. Iwai K, et al. Anti-tumor efficacy of a novel CLK inhibitor via targeting RNA splicing and MYC-dependent vulnerability. EMBO Mol Med. 2018 Jun;10(6). pii: e8289. |
