For research use only. Not for therapeutic Use.
T16Ainh-A01 (CAT: I011849) is a selective inhibitor of the calcium-activated chloride channel TMEM16A (also known as ANO1). It blocks the activity of TMEM16A by directly binding to the channel protein, thereby inhibiting chloride ion transport. TMEM16A channels are involved in various physiological processes, including smooth muscle contraction, regulation of electrical excitability, and secretion of fluids. By specifically targeting TMEM16A, T16Ainh-A01 has been studied for its potential therapeutic applications in conditions such as cystic fibrosis, hypertension, and cancer, where aberrant TMEM16A function plays a role. T16Ainh-A01 offers a valuable tool to investigate the physiological and pathological roles of TMEM16A channels and may have future clinical applications.
| Catalog Number | I011849 |
| CAS Number | 552309-42-9 |
| Synonyms | T16Ainh-A01;2-[(5-Ethyl-1,6-dihydro-4-methyl-6-oxo-2-pyrimidinyl)thio]-N-[4-(4-methoxyphenyl)-2-thiazolyl]acetamide |
| Molecular Formula | C19H20N4O3S2 |
| Purity | ≥95% |
| Target | Chloride Channel |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Store at +4°C |
| IUPAC Name | 2-[(5-ethyl-6-methyl-4-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
| InChI | InChI=1S/C19H20N4O3S2/c1-4-14-11(2)20-18(23-17(14)25)28-10-16(24)22-19-21-15(9-27-19)12-5-7-13(26-3)8-6-12/h5-9H,4,10H2,1-3H3,(H,20,23,25)(H,21,22,24) |
| InChIKey | QSIYTNYMBWYHAA-UHFFFAOYSA-N |
| SMILES | CCC1=C(NC(=NC1=O)SCC(=O)NC2=NC(=CS2)C3=CC=C(C=C3)OC)C |
| Reference | 1: Deba F, Bessac BF. Anoctamin-1 Cl(-) channels in nociception: activation by an |
