For research use only. Not for therapeutic Use.
TA-01 (Cat No.:I002312) is a small molecule inhibitor of the transforming growth factor-beta (TGF-β) pathway. It binds to the transcription factor forkhead box protein O4 (FoxO4) and prevents its phosphorylation, leading to increased nuclear localization and activation of FoxO4. This, in turn, promotes the transcription of target genes involved in TGF-β signaling, such as Smad7. TA-01 has been shown to inhibit TGF-β-induced epithelial-to-mesenchymal transition (EMT) in cancer cells and reduce fibrosis in animal models. It has potential therapeutic applications in cancer and fibrotic diseases.
CAS Number | 1784751-18-3 |
Synonyms | 4-(2-(2,6-difluorophenyl)-4-(4-fluorophenyl)-1H-imidazol-5-yl)pyridine |
Molecular Formula | C₂₀H₁₂F₃N₃ |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IC50 | 6.4/6.8/6.7 nM |
IUPAC Name | 4-[2-(2,6-difluorophenyl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine |
InChI | InChI=1S/C20H12F3N3/c21-14-6-4-12(5-7-14)18-19(13-8-10-24-11-9-13)26-20(25-18)17-15(22)2-1-3-16(17)23/h1-11H,(H,25,26) |
InChIKey | TWPJJJZCYVFUOA-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)F)C2=NC(=C(N2)C3=CC=NC=C3)C4=CC=C(C=C4)F)F |
Reference | <p style=/line-height:25px/> </p> |