For research use only. Not for therapeutic Use.
Tadalafil-d3(Cat No.:S000322) is a deuterated form of tadalafil, where three hydrogen atoms are replaced with deuterium. Tadalafil is a phosphodiesterase type 5 (PDE5) inhibitor used primarily to treat erectile dysfunction (ED) and benign prostatic hyperplasia (BPH). The introduction of deuterium enhances the molecular stability of tadalafil, allowing for more precise pharmacokinetic and metabolic studies. This isotopic labeling aids in tracking the drug’s absorption, distribution, metabolism, and excretion, providing deeper insights that can lead to improved therapeutic efficacy, optimized dosing, and potentially reduced side effects in the treatment of ED and BPH.
CAS Number | 960226-55-5 |
Molecular Formula | C22H16D3N3O4 |
Purity | ≥95% |
Target | Phosphodiesterase (PDE) |
IUPAC Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-(trideuteriomethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
InChI | InChI=1S/C22H19N3O4/c1-24-10-19(26)25-16(22(24)27)9-14-13-4-2-3-5-15(13)23-20(14)21(25)12-6-7-17-18(8-12)29-11-28-17/h2-8,16,21,23H,9-11H2,1H3/t16-,21-/m1/s1/i1D3 |
InChIKey | WOXKDUGGOYFFRN-WFMNTJQSSA-N |
SMILES | CN1CC(=O)N2C(C1=O)CC3=C(C2C4=CC5=C(C=C4)OCO5)NC6=CC=CC=C36 |