For research use only. Not for therapeutic Use.
TAK-659 Hydrochloride（Cat No.:I001898）is a selective inhibitor of spleen tyrosine kinase (SYK), used in the treatment of hematologic malignancies and autoimmune diseases. By blocking SYK activity, it disrupts signaling pathways critical for the proliferation and survival of cancer cells and immune cells. TAK-659 Hydrochloride is under investigation for its potential to enhance therapeutic outcomes in conditions like non-Hodgkin lymphoma and chronic lymphocytic leukemia. Its specificity and efficacy make it a promising candidate in targeted cancer therapy and immunomodulation research, contributing to the development of advanced treatments.
| Catalog Number | I001898 |
| CAS Number | 1952251-28-3 |
| Synonyms | 6-[[(1R,2S)-2-aminocyclohexyl]amino]-7-fluoro-4-(1-methylpyrazol-4-yl)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one;hydrochloride |
| Molecular Formula | C17H22ClFN6O |
| Purity | ≥95% |
| IUPAC Name | 6-[[(1R,2S)-2-aminocyclohexyl]amino]-7-fluoro-4-(1-methylpyrazol-4-yl)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one;hydrochloride |
| InChI | InChI=1S/C17H21FN6O.ClH/c1-24-8-9(6-21-24)15-13-10(7-20-17(13)25)14(18)16(23-15)22-12-5-3-2-4-11(12)19;/h6,8,11-12H,2-5,7,19H2,1H3,(H,20,25)(H,22,23);1H/t11-,12+;/m0./s1 |
| InChIKey | PTCFBXMEFRIEGV-ZVWHLABXSA-N |
| SMILES | CN1C=C(C=N1)C2=NC(=C(C3=C2C(=O)NC3)F)NC4CCCCC4N.Cl |
