For research use only. Not for therapeutic Use.
Talabostat mesylate (CAT: I009692) is a small molecule inhibitor of dipeptidyl peptidase IV (DPP-IV), an enzyme involved in the degradation of incretin hormones that regulate glucose metabolism. By inhibiting DPP-IV, talabostat mesylate increases the levels of active incretin hormones, such as glucagon-like peptide-1 (GLP-1), leading to improved glycemic control. Talabostat mesylate has been investigated as a potential treatment for type 2 diabetes mellitus and has shown promising results in preclinical and clinical studies. Additionally, talabostat mesylate has demonstrated immunomodulatory effects by inhibiting pro-inflammatory cytokine production and has been explored for its potential anti-inflammatory and anti-cancer properties.
| Catalog Number | I009692 |
| CAS Number | 150080-09-4 |
| Synonyms | PT-100; PT100; PT 100; D05989; Val-boro-pro; Talabostat.;(R)-1-((S)-2-amino-3-methylbutanoyl)pyrrolidin-2-ylboronic acid methanesulfonic acid (1:1) |
| Molecular Formula | C10H23BN2O6S |
| Purity | ≥95% |
| Target | Dipeptidyl Peptidase |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| SMILES | OB([C@H]1N(C([C@@H](N)C(C)C)=O)CCC1)O.CS(=O)(O)=O |
| Reference | 1: Eager RM, Cunningham CC, Senzer N, Richards DA, Raju RN, Jones B, Uprichard M, |
