For research use only. Not for therapeutic Use.
(-)-Talarozole（Cat No.:I020463）is a selective retinoic acid metabolism blocking agent (RAMBA) known for inhibiting cytochrome P450 enzyme CYP26, which metabolizes retinoic acid. By preventing the breakdown of retinoic acid, (-)-Talarozole enhances its biological activity, making it valuable in dermatology and oncology research. It is primarily investigated for treating skin disorders such as acne and psoriasis, as well as for potential applications in certain cancers. Its specificity and effectiveness provide a useful tool for studying retinoic acid-related pathways and exploring novel therapeutic strategies.
| Catalog Number | I020463 |
| CAS Number | 201410-67-5 |
| Molecular Formula | C₂₁H₂₃N₅S |
| Purity | ≥95% |
| Target | Vitamin D Related/Nuclear Receptor |
| IUPAC Name | N-[4-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]phenyl]-1,3-benzothiazol-2-amine |
| InChI | InChI=1S/C21H23N5S/c1-3-15(4-2)20(26-14-22-13-23-26)16-9-11-17(12-10-16)24-21-25-18-7-5-6-8-19(18)27-21/h5-15,20H,3-4H2,1-2H3,(H,24,25) |
| InChIKey | SNFYYXUGUBUECJ-UHFFFAOYSA-N |
| SMILES | CCC(CC)C(C1=CC=C(C=C1)NC2=NC3=CC=CC=C3S2)N4C=NC=N4 |
| Reference | [1]. Marc Gaston Venet, et al. N-[4-(heteroarylmethyl)phenyl]-heteroarylamines. WO 1997049704 A1. |
