TAME (Cat No.:A000821) is a cell-permeable, fluorescent dye commonly used as a mitochondrial membrane potential indicator in biological research. By selectively accumulating in mitochondria, TAME allows researchers to monitor changes in mitochondrial function, particularly during apoptosis or metabolic activity. Its fluorescence intensity correlates with the mitochondrial membrane potential, making it useful for studying cellular health, energy metabolism, and disease states, such as neurodegenerative disorders and cancer. TAME is widely employed in fluorescence microscopy and flow cytometry for real-time visualization of mitochondrial dynamics.
| Catalog Number | A000821 |
| CAS Number | 901-47-3 |
| Synonyms | NA |
| Molecular Formula | C14H22N4O4S |
| Purity | ≥95% |
| Target | APC |
| Storage | 3 years -20C powder |
| IUPAC Name | methyl (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoate |
| InChI | InChI=1S/C14H22N4O4S/c1-10-5-7-11(8-6-10)23(20,21)18-12(13(19)22-2)4-3-9-17-14(15)16/h5-8,12,18H,3-4,9H2,1-2H3,(H4,15,16,17)/t12-/m0/s1 |
| InChIKey | FKMJXALNHKIDOD-LBPRGKRZSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)OC |
