TAME Hydrochloride (Cat No.:R026997) is a synthetic serine protease inhibitor commonly used in biochemical research. It inhibits trypsin-like proteases by covalently modifying the enzyme’s active site, making it valuable for studying protease activity and protein degradation pathways. TAME Hydrochloride is often utilized in enzyme assays, protease characterization, and research involving clotting mechanisms. Its specificity for serine proteases makes it an essential tool in understanding proteolytic processes, contributing to pharmaceutical and biomedical research, especially in enzyme regulation and drug development.
| Catalog Number | R026997 |
| CAS Number | 1784-03-8 |
| Synonyms | (S)-Methyl 5-guanidino-2-(4-methylphenylsulfonamido)pentanoate Hydrochloride; |
| Molecular Formula | C14H23ClN4O4S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | methyl (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoate;hydrochloride |
| InChI | InChI=1S/C14H22N4O4S.ClH/c1-10-5-7-11(8-6-10)23(20,21)18-12(13(19)22-2)4-3-9-17-14(15)16;/h5-8,12,18H,3-4,9H2,1-2H3,(H4,15,16,17);1H/t12-;/m0./s1 |
| InChIKey | JIQFFACVQXXHMY-YDALLXLXSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)OC.Cl |
