For research use only. Not for therapeutic Use.
Taminadenant(Cat No.:I019540) is an antagonist of adenosine receptors. Adenosine receptors are G protein-coupled receptors that are involved in regulating various physiological processes, including neurotransmission, inflammation, and immune responses. By acting as an antagonist, taminadenant inhibits the binding of adenosine to its receptors, thereby blocking the downstream signaling pathways associated with adenosine receptor activation. This antagonist activity has potential implications in the development of therapeutics targeting adenosine receptor-mediated pathways, such as in the treatment of inflammatory diseases or neurological disorders.
| Catalog Number | I019540 |
| CAS Number | 1337962-47-6 |
| Molecular Formula | C₁₀H₈BrN₇ |
| Purity | ≥95% |
| IUPAC Name | 5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine |
| InChI | InChI=1S/C10H8BrN7/c11-7-8(12)15-10(18-6-2-4-14-18)16-9(7)17-5-1-3-13-17/h1-6H,(H2,12,15,16) |
| InChIKey | ATFXVNUWQOXRRU-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=NC(=NC(=C2Br)N)N3C=CC=N3 |
| Reference | [1]. International Nonproprietary Names for Pharmaceutical Substances (INN). WHO Drug Information, 2018, 32(4). |
