Tamoxifen-13C6 is a stable isotope-labeled form of tamoxifen, enriched with six 13C atoms. This high-purity compound is essential for advanced pharmaceutical and biochemical research, particularly in studying the pharmacokinetics, metabolic pathways, and drug interactions of tamoxifen. Its precise isotope labeling ensures accurate and reliable analytical results. Tamoxifen-13C6 is ideal for research on estrogen receptor modulation and breast cancer treatment, offering a robust and consistent tool for high-precision scientific investigations, seamlessly integrating into existing research protocols.
| Catalog Number | R053296 |
| CAS Number | 1346606-38-9 |
| Synonyms | (Z)-2-[4-[1-(phenyl-13C6)-2-phenyl-1-butenyl]phenoxy]-N,N-dimethylethanamine; ICI 47699-13C6; Mammaton-13C6; Novaldex-13C6; Tamoxifen-13C6; Z-Tamoxifen-13C6; trans-Tamoxifen-13C6; |
| Molecular Formula | C26H29NO |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-[4-[(E)-1,2-di(phenyl)but-1-enyl]phenoxy]-N,N-dimethylethanamine |
| InChI | InChI=1S/C26H29NO/c1-4-25(21-11-7-5-8-12-21)26(22-13-9-6-10-14-22)23-15-17-24(18-16-23)28-20-19-27(2)3/h5-18H,4,19-20H2,1-3H3/b26-25-/i6+1,9+1,10+1,13+1,14+1,22+1 |
| InChIKey | NKANXQFJJICGDU-JTAPQUQISA-N |
| SMILES | CCC(=C(C1=CC=CC=C1)C2=CC=C(C=C2)OCCN(C)C)C3=CC=CC=C3 |
