For research use only. Not for therapeutic Use.
Tamsulosin（Cat No.:I000310）is a selective alpha-1 adrenergic receptor antagonist primarily used to treat benign prostatic hyperplasia (BPH). By relaxing the smooth muscles in the prostate and bladder neck, it improves urine flow and reduces BPH symptoms such as difficulty urinating and frequent urination. Tamsulosin’s high selectivity for alpha-1 receptors minimizes cardiovascular side effects, making it a preferred choice for managing BPH. It is typically well-tolerated and is available in oral form. Tamsulosin is also investigated for its potential in treating other urinary tract disorders.
| Catalog Number | I000310 |
| CAS Number | 106133-20-4 |
| Molecular Formula | C20H28N2O5S |
| Purity | ≥95% |
| Target | α1 receptor |
| Solubility | DMSO > 52 mg/ml |
| Storage | Store at -20°C |
| IUPAC Name | 5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide |
| InChI | InChI=1S/C20H28N2O5S/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24)/t15-/m1/s1 |
| InChIKey | DRHKJLXJIQTDTD-OAHLLOKOSA-N |
| SMILES | CCOC1=CC=CC=C1OCCNC(C)CC2=CC(=C(C=C2)OC)S(=O)(=O)N |
