For research use only. Not for therapeutic Use.
TAPI-0 (Cat No.:I037001) is a potent synthetic inhibitor of matrix metalloproteinases (MMPs), particularly targeting MMP-2 and MMP-9. These enzymes play key roles in the breakdown of extracellular matrix proteins, which is crucial in tissue remodeling, wound healing, and cancer metastasis. By inhibiting MMP activity, TAPI-0 helps reduce tissue degradation and inflammation, making it a potential therapeutic candidate for diseases involving excessive tissue remodeling, such as rheumatoid arthritis, cancer, and cardiovascular diseases. Its ability to modulate MMPs offers significant promise in managing chronic inflammatory conditions.
CAS Number | 163958-73-4 |
Synonyms | (2R)-N-[(2S)-1-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-N’-hydroxy-2-(2-methylpropyl)butanediamide |
Molecular Formula | C24H32N4O5 |
Purity | ≥95% |
IUPAC Name | (2R)-N-[(2S)-1-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
InChI | InChI=1S/C24H32N4O5/c1-14(2)10-19(13-21(29)28-33)23(31)27-20(24(32)26-15(3)22(25)30)12-16-8-9-17-6-4-5-7-18(17)11-16/h4-9,11,14-15,19-20,33H,10,12-13H2,1-3H3,(H2,25,30)(H,26,32)(H,27,31)(H,28,29)/t15-,19+,20-/m0/s1 |
InChIKey | CRCPLBFLOSEABN-BEVDRBHNSA-N |
SMILES | C[C@@H](C(=O)N)NC(=O)[C@H](CC1=CC2=CC=CC=C2C=C1)NC(=O)[C@H](CC(C)C)CC(=O)NO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |