For research use only. Not for therapeutic Use.
TAPI-1(Cat No.:I002135)is a broad-spectrum metalloprotease inhibitor known for its ability to inhibit tumor necrosis factor-alpha converting enzyme (TACE/ADAM17) and matrix metalloproteinases (MMPs). By blocking these proteases, TAPI-1 prevents the cleavage and release of membrane-bound proteins such as TNF-α, thereby modulating inflammatory responses and reducing tissue degradation. It has been widely studied for its potential in treating inflammatory diseases, cancer, and cardiovascular conditions, where metalloprotease activity plays a crucial role. TAPI-1 is a valuable tool for researchers exploring protease-mediated pathways in various pathological conditions.
CAS Number | 163847-77-6 |
Molecular Formula | C26H37N5O5 |
Purity | ≥95% |
Target | MMP |
Solubility | DMSO: ≥ 34 mg/mL |
Storage | Store at -20°C |
IUPAC Name | (2R)-N-[(2S)-1-[[(2S)-1-(2-aminoethylamino)-1-oxopropan-2-yl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
InChI | InChI=1S/C26H37N5O5/c1-16(2)12-21(15-23(32)31-36)25(34)30-22(26(35)29-17(3)24(33)28-11-10-27)14-18-8-9-19-6-4-5-7-20(19)13-18/h4-9,13,16-17,21-22,36H,10-12,14-15,27H2,1-3H3,(H,28,33)(H,29,35)(H,30,34)(H,31,32)/t17-,21+,22-/m0/s1 |
InChIKey | AWNBSWDIOCXWJW-WTOYTKOKSA-N |
SMILES | C[C@@H](C(=O)NCCN)NC(=O)[C@H](CC1=CC2=CC=CC=C2C=C1)NC(=O)[C@H](CC(C)C)CC(=O)NO |
Reference | <p style=/line-height:25px/> |