For research use only. Not for therapeutic Use.
Taraxero(CAT: M069965) is a naturally occurring triterpene compound found in various plant sources, including certain medicinal herbs. Its mode of action involves being a member of the pentacyclic triterpenoids, which have been studied for their potential pharmacological activities. Taraxerol is known for its anti-inflammatory, antioxidant, and anticancer properties. It has been the subject of research for its potential therapeutic applications, particularly in traditional medicine and herbal remedies.
| Catalog Number | M069965 |
| CAS Number | 127-22-0 |
| Molecular Formula | C30H50O |
| Purity | ≥95% |
| Target | NF-κB |
| Storage | -20°C |
| IUPAC Name | (3S,4aR,6aR,6aS,8aR,12aR,14aR,14bR)-4,4,6a,6a,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,8,9,10,12,12a,13,14,14a-tetradecahydropicen-3-ol |
| InChI | InChI=1S/C30H50O/c1-25(2)17-18-27(5)13-9-21-29(7)14-10-20-26(3,4)24(31)12-16-28(20,6)22(29)11-15-30(21,8)23(27)19-25/h9,20,22-24,31H,10-19H2,1-8H3/t20-,22+,23+,24-,27-,28-,29-,30+/m0/s1 |
| InChIKey | GGGUGZHBAOMSFJ-GADYQYKKSA-N |
| SMILES | CC1(CCC2(CC=C3C4(CCC5C(C(CCC5(C4CCC3(C2C1)C)C)O)(C)C)C)C)C |
