For research use only. Not for therapeutic Use.
TAS-109 is a fluoropyrimidine-based oral prodrug developed for cancer treatment, specifically targeting tumors by interfering with DNA synthesis. It is converted into its active form within the body, leading to the inhibition of thymidylate synthase, a key enzyme required for DNA replication. This mechanism helps to prevent the growth and proliferation of cancer cells. TAS-109 is studied for its potential effectiveness in treating various solid tumors, offering a targeted approach with the goal of improving therapeutic outcomes in cancer patients.
| Catalog Number | I009710 |
| CAS Number | 135598-68-4 |
| Synonyms | TAS109; TAS109; TAS 109; DFP-10917; DFP 10917; DFP10917. CNDAC.;(2R,3S,4S,5R)-2-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolane-3-carbonitrile |
| Molecular Formula | C10H12N4O4 |
| Purity | ≥95% |
| Target | f DNA polymerase inhibitor |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| SMILES | N#C[C@@H]1[C@H](N2C=CC(N)=NC2=O)O[C@H](CO)[C@H]1O |
