For research use only. Not for therapeutic Use.
Thyrotropin（Cat No.:I043598）, also known as thyroid-stimulating hormone (TSH), is a glycoprotein hormone produced by the pituitary gland. It plays a crucial role in regulating thyroid function by stimulating the thyroid gland to produce and release thyroid hormones, namely thyroxine (T4) and triiodothyronine (T3). These hormones regulate metabolism, growth, and development in the body. Thyrotropin levels are commonly measured to assess thyroid function, particularly in the diagnosis of thyroid disorders such as hypothyroidism, hyperthyroidism, and thyroid cancer. Recombinant thyrotropin is also used therapeutically for diagnostic purposes in patients undergoing thyroid cancer treatment.
| CAS Number | 1465908-73-9 |
| Synonyms | 2-(5-methoxy-3,4-dihydro-1H-isochromen-1-yl)-4,5-dihydro-1H-imidazole;sulfuric acid |
| Molecular Formula | C13H18N2O6S |
| Purity | ≥95% |
| IUPAC Name | 2-(5-methoxy-3,4-dihydro-1H-isochromen-1-yl)-4,5-dihydro-1H-imidazole;sulfuric acid |
| InChI | InChI=1S/C13H16N2O2.H2O4S/c1-16-11-4-2-3-10-9(11)5-8-17-12(10)13-14-6-7-15-13;1-5(2,3)4/h2-4,12H,5-8H2,1H3,(H,14,15);(H2,1,2,3,4) |
| InChIKey | HZWPSPYSMWTZTG-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1CCOC2C3=NCCN3.OS(=O)(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
