For research use only. Not for therapeutic Use.
Tauro-β-muricholic acid(Cat No.:R040541), is a bile acid derivative found in the digestive system of mammals, including humans and rodents. It plays a crucial role in the emulsification and digestion of dietary fats and the absorption of fat-soluble vitamins. Tauro-β-muricholic acid is a primary bile acid formed in the liver and later conjugated with the amino acid taurine to become water-soluble. This conjugation enhances its detergent properties, facilitating the breakdown and absorption of dietary lipids. Bile acids like tauro-β-muricholic acid are vital components of the digestive process, ensuring efficient fat digestion and nutrient absorption.
Catalog Number | R040541 |
CAS Number | 25696-60-0 |
Synonyms | 2-[[(3α,5β,6β,7β)-3,6,7-Trihydroxy-24-oxocholan-24-yl]amino]-ethanesulfonic Acid;?N-(3α,6β,7β-Trihydroxy-5β-cholan-24-oyl)-taurine; Tauro-β-muricholate; |
Molecular Formula | C26H45NO7S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[[(4R)-4-[(3R,5R,6S,7R,10R,13R,17R)-3,6,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid |
InChI | InChI=1S/C26H45NO7S/c1-15(4-7-21(29)27-12-13-35(32,33)34)17-5-6-18-22-19(9-11-25(17,18)2)26(3)10-8-16(28)14-20(26)23(30)24(22)31/h15-20,22-24,28,30-31H,4-14H2,1-3H3,(H,27,29)(H,32,33,34)/t15-,16-,17-,18?,19?,20+,22?,23+,24-,25-,26-/m1/s1 |
InChIKey | XSOLDPYUICCHJX-OEYGYFRSSA-N |
SMILES | CC(CCC(=O)NCCS(=O)(=O)O)C1CCC2C1(CCC3C2C(C(C4C3(CCC(C4)O)C)O)O)C |