For research use only. Not for therapeutic Use.
Taurolithocholic Acid-d5 sodium(Cat No.:S000798) is an isotopically labeled form of taurolithocholic acid (TLCA), a secondary bile acid involved in lipid digestion and absorption. The “d5 sodium” designation indicates that five hydrogen atoms in the TLCA molecule are replaced with deuterium, a stable isotope of hydrogen, and it exists as a sodium salt. This isotopic labeling enables precise tracking of TLCA metabolism and its incorporation into bile acid pathways using advanced analytical techniques like mass spectrometry. Taurolithocholic Acid-d5 sodium serves as a valuable tool in metabolic studies, aiding in elucidating pathways and investigating bile acid-related disorders.
Catalog Number | S000798 |
CAS Number | 1265476-97-8 |
Molecular Formula | C26H40D5NNaO5S |
Purity | ≥95% |
IUPAC Name | sodium;2-[[(4R)-4-[(3R,5R,8R,10S,13R,14S)-2,2,3,4,4-pentadeuterio-3-hydroxy-10,13-dimethyl-1,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonate |
InChI | InChI=1S/C26H45NO5S.Na/c1-17(4-9-24(29)27-14-15-33(30,31)32)21-7-8-22-20-6-5-18-16-19(28)10-12-25(18,2)23(20)11-13-26(21,22)3;/h17-23,28H,4-16H2,1-3H3,(H,27,29)(H,30,31,32);/q;+1/p-1/t17-,18-,19-,20+,21?,22+,23?,25+,26-;/m1./s1/i10D2,16D2,19D; |
InChIKey | YAERYJYXPRIDTO-SDXLJUFPSA-M |
SMILES | CC(CCC(=O)NCCS(=O)(=O)[O-])C1CCC2C1(CCC3C2CCC4C3(CCC(C4)O)C)C.[Na+] |